C22H22ClNO6 — CID 51034535
4-[[3-chloro-4,5-di(cyclobutyloxy)benzoyl]amino]-2-hydroxybenzoic acid (PubChem CID 51034535) has the molecular formula C22H22ClNO6 and a molecular weight of 431.87 g/mol. Its IUPAC name is 4-[[3-chloro-4,5-di(cyclobutyloxy)benzoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[3-chloro-4,5-di(cyclobutyloxy)benzoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 51034535 |
| Molecular Formula | C22H22ClNO6 |
| Molecular Weight | 431.87 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 4-[[3-chloro-4,5-di(cyclobutyloxy)benzoyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)c(O)c1)c1cc(Cl)c(OC2CCC2)c(OC2CCC2)c1 |
| InChI | InChI=1S/C22H22ClNO6/c23-17-9-12(21(26)24-13-7-8-16(22(27)28)18(25)11-13)10-19(29-14-3-1-4-14)20(17)30-15-5-2-6-15/h7-11,14-15,25H,1-6H2,(H,24,26)(H,27,28) |
| InChIKey | OAMJSCGXYMTLRF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.87 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |