C50H58Cl2N2O11 — CID 159957850
3-chloro-4,5-dicyclopentyloxybenzoic acid;methyl 4-aminobenzoate;methyl 4-[(3-chloro-4,5-dicyclopentyloxybenzoyl)amino]benzoate (PubChem CID 159957850) has the molecular formula C50H58Cl2N2O11 and a molecular weight of 933.92 g/mol. Its IUPAC name is 3-chloro-4,5-dicyclopentyloxybenzoic acid;methyl 4-aminobenzoate;methyl 4-[(3-chloro-4,5-dicyclopentyloxybenzoyl)amino]benzoate.
| Compound Name | 3-chloro-4,5-dicyclopentyloxybenzoic acid;methyl 4-aminobenzoate;methyl 4-[(3-chloro-4,5-dicyclopentyloxybenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 159957850 |
| Molecular Formula | C50H58Cl2N2O11 |
| Molecular Weight | 933.92 g/mol |
| Exact Mass | 932.34 |
| IUPAC Name | 3-chloro-4,5-dicyclopentyloxybenzoic acid;methyl 4-aminobenzoate;methyl 4-[(3-chloro-4,5-dicyclopentyloxybenzoyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(N)cc1.COC(=O)c1ccc(NC(=O)c2cc(Cl)c(OC3CCCC3)c(OC3CCCC3)c2)cc1.O=C(O)c1cc(Cl)c(OC2CCCC2)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C25H28ClNO5.C17H21ClO4.C8H9NO2/c1-30-25(29)16-10-12-18(13-11-16)27-24(28)17-14-21(26)23(32-20-8-4-5-9-20)22(15-17)31-19-6-2-3-7-19;18-14-9-11(17(19)20)10-15(21-12-5-1-2-6-12)16(14)22-13-7-3-4-8-13;1-11-8(10)6-2-4-7(9)5-3-6/h10-15,19-20H,2-9H2,1H3,(H,27,28);9-10,12-13H,1-8H2,(H,19,20);2-5H,9H2,1H3 |
| InChIKey | OCYFFWKHBOMEOQ-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 181.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.92 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|