C14H21F3N2O — CID 106141163
5-[4-amino-3-(trifluoromethyl)anilino]-4,4-dimethylpentan-1-ol (PubChem CID 106141163) has the molecular formula C14H21F3N2O and a molecular weight of 290.33 g/mol. Its IUPAC name is 5-[4-amino-3-(trifluoromethyl)anilino]-4,4-dimethylpentan-1-ol.
| Compound Name | 5-[4-amino-3-(trifluoromethyl)anilino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 106141163 |
| Molecular Formula | C14H21F3N2O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 5-[4-amino-3-(trifluoromethyl)anilino]-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(CCCO)CNc1ccc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H21F3N2O/c1-13(2,6-3-7-20)9-19-10-4-5-12(18)11(8-10)14(15,16)17/h4-5,8,19-20H,3,6-7,9,18H2,1-2H3 |
| InChIKey | ZXFGINQHUQMCMU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|