C14H20BrNO3 — CID 106149542
2-bromo-4-[(5-hydroxy-2,2-dimethylpentyl)amino]benzoic acid (PubChem CID 106149542) has the molecular formula C14H20BrNO3 and a molecular weight of 330.22 g/mol. Its IUPAC name is 2-bromo-4-[(5-hydroxy-2,2-dimethylpentyl)amino]benzoic acid.
| Compound Name | 2-bromo-4-[(5-hydroxy-2,2-dimethylpentyl)amino]benzoic acid |
|---|---|
| PubChem CID | 106149542 |
| Molecular Formula | C14H20BrNO3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-bromo-4-[(5-hydroxy-2,2-dimethylpentyl)amino]benzoic acid |
| SMILES | CC(C)(CCCO)CNc1ccc(C(=O)O)c(Br)c1 |
| InChI | InChI=1S/C14H20BrNO3/c1-14(2,6-3-7-17)9-16-10-4-5-11(13(18)19)12(15)8-10/h4-5,8,16-17H,3,6-7,9H2,1-2H3,(H,18,19) |
| InChIKey | AMXYZLLGGYOFNZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |