C10H10BrF2NO3 — CID 106178629
2-bromo-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzoic acid (PubChem CID 106178629) has the molecular formula C10H10BrF2NO3 and a molecular weight of 310.09 g/mol. Its IUPAC name is 2-bromo-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzoic acid.
| Compound Name | 2-bromo-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzoic acid |
|---|---|
| PubChem CID | 106178629 |
| Molecular Formula | C10H10BrF2NO3 |
| Molecular Weight | 310.09 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 2-bromo-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NCC(F)(F)CO)cc1Br |
| InChI | InChI=1S/C10H10BrF2NO3/c11-8-3-6(1-2-7(8)9(16)17)14-4-10(12,13)5-15/h1-3,14-15H,4-5H2,(H,16,17) |
| InChIKey | OXORORTUYBDDRP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.09 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |