C10H9BrF2N2O — CID 106172235
2-bromo-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile (PubChem CID 106172235) has the molecular formula C10H9BrF2N2O and a molecular weight of 291.10 g/mol. Its IUPAC name is 2-bromo-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile.
| Compound Name | 2-bromo-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile |
|---|---|
| PubChem CID | 106172235 |
| Molecular Formula | C10H9BrF2N2O |
| Molecular Weight | 291.10 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 2-bromo-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile |
| SMILES | N#Cc1ccc(NCC(F)(F)CO)cc1Br |
| InChI | InChI=1S/C10H9BrF2N2O/c11-9-3-8(2-1-7(9)4-14)15-5-10(12,13)6-16/h1-3,15-16H,5-6H2 |
| InChIKey | ZBMSWIHAJBSFKP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.10 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |