C16H24BrNO2 — CID 107282204
2-bromo-4-(2,2-dimethylheptylamino)benzoic acid (PubChem CID 107282204) has the molecular formula C16H24BrNO2 and a molecular weight of 342.28 g/mol. Its IUPAC name is 2-bromo-4-(2,2-dimethylheptylamino)benzoic acid.
| Compound Name | 2-bromo-4-(2,2-dimethylheptylamino)benzoic acid |
|---|---|
| PubChem CID | 107282204 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-bromo-4-(2,2-dimethylheptylamino)benzoic acid |
| SMILES | CCCCCC(C)(C)CNc1ccc(C(=O)O)c(Br)c1 |
| InChI | InChI=1S/C16H24BrNO2/c1-4-5-6-9-16(2,3)11-18-12-7-8-13(15(19)20)14(17)10-12/h7-8,10,18H,4-6,9,11H2,1-3H3,(H,19,20) |
| InChIKey | ITHKPDJMRGQJEB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|