About 4-[(3-hydroxy-2,2-dimethylpropyl)amino]-2-methylbenzoic acid
4-[(3-hydroxy-2,2-dimethylpropyl)amino]-2-methylbenzoic acid (PubChem CID 115363246) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-[(3-hydroxy-2,2-dimethylpropyl)amino]-2-methylbenzoic acid.
Analyze 4-[(3-hydroxy-2,2-dimethylpropyl)amino]-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-hydroxy-2,2-dimethylpropyl)amino]-2-methylbenzoic acid?
The IUPAC name of 4-[(3-hydroxy-2,2-dimethylpropyl)amino]-2-methylbenzoic acid (CID 115363246) is 4-[(3-hydroxy-2,2-dimethylpropyl)amino]-2-methylbenzoic acid.
What is the SMILES notation for 4-[(3-hydroxy-2,2-dimethylpropyl)amino]-2-methylbenzoic acid?
The canonical SMILES for 4-[(3-hydroxy-2,2-dimethylpropyl)amino]-2-methylbenzoic acid is Cc1cc(NCC(C)(C)CO)ccc1C(=O)O.
What is the InChIKey of 4-[(3-hydroxy-2,2-dimethylpropyl)amino]-2-methylbenzoic acid?
The InChIKey is YULLIXWGTLWJPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c1-9-6-10(4-5-11(9)12(16)17)14-7-13(2,3)8-15/h4-6,14-15H,7-8H2,1-3H3,(H,16,17).
What are the key properties of 4-[(3-hydroxy-2,2-dimethylpropyl)amino]-2-methylbenzoic acid?
4-[(3-hydroxy-2,2-dimethylpropyl)amino]-2-methylbenzoic acid has a molecular weight of 237.30 g/mol, XLogP of 2.12, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-hydroxy-2,2-dimethylpropyl)amino]-2-methylbenzoic acid is sourced from PubChem (CID 115363246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).