4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid

C14H21NO3 — CID 106190045

IUPAC4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid
SMILESCc1cc(NC(C)(C)C(C)(C)O)ccc1C(=O)O
InChIInChI=1S/C14H21NO3/c1-9-8-10(6-7-11(9)12(16)17)15-13(2,3)14(4,5)18/h6-8,15,18H,1-5H3,(H,16,17)
InChIKeyLROCUNOAAXONQT-UHFFFAOYSA-N
MW251.33 g/mol
LogP2.65
Rot. Bonds4

About 4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid

4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid (PubChem CID 106190045) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid.

Molecular Properties

Compound Name4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid
PubChem CID106190045
Molecular FormulaC14H21NO3
Molecular Weight251.33 g/mol
Exact Mass251.15
IUPAC Name4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid
SMILESCc1cc(NC(C)(C)C(C)(C)O)ccc1C(=O)O
InChIInChI=1S/C14H21NO3/c1-9-8-10(6-7-11(9)12(16)17)15-13(2,3)14(4,5)18/h6-8,15,18H,1-5H3,(H,16,17)
InChIKeyLROCUNOAAXONQT-UHFFFAOYSA-N
XLogP2.65
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.33
LogP ≤ 52.65
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid?
The IUPAC name of 4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid (CID 106190045) is 4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid.
What is the SMILES notation for 4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid?
The canonical SMILES for 4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid is Cc1cc(NC(C)(C)C(C)(C)O)ccc1C(=O)O.
What is the InChIKey of 4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid?
The InChIKey is LROCUNOAAXONQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3/c1-9-8-10(6-7-11(9)12(16)17)15-13(2,3)14(4,5)18/h6-8,15,18H,1-5H3,(H,16,17).
What are the key properties of 4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid?
4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid has a molecular weight of 251.33 g/mol, XLogP of 2.65, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-methylbenzoic acid is sourced from PubChem (CID 106190045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).