C13H18N2O5 — CID 106190056
4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-nitrobenzoic acid (PubChem CID 106190056) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-nitrobenzoic acid.
| Compound Name | 4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 106190056 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-2-nitrobenzoic acid |
| SMILES | CC(C)(O)C(C)(C)Nc1ccc(C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H18N2O5/c1-12(2,13(3,4)18)14-8-5-6-9(11(16)17)10(7-8)15(19)20/h5-7,14,18H,1-4H3,(H,16,17) |
| InChIKey | NDAQBHABIHHWOL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|