C14H22N2O3 — CID 106145258
4,4-dimethyl-5-(4-methyl-3-nitroanilino)pentan-1-ol (PubChem CID 106145258) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 4,4-dimethyl-5-(4-methyl-3-nitroanilino)pentan-1-ol.
| Compound Name | 4,4-dimethyl-5-(4-methyl-3-nitroanilino)pentan-1-ol |
|---|---|
| PubChem CID | 106145258 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 4,4-dimethyl-5-(4-methyl-3-nitroanilino)pentan-1-ol |
| SMILES | Cc1ccc(NCC(C)(C)CCCO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H22N2O3/c1-11-5-6-12(9-13(11)16(18)19)15-10-14(2,3)7-4-8-17/h5-6,9,15,17H,4,7-8,10H2,1-3H3 |
| InChIKey | XVKGTDRDWHXNRY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|