C13H21N3O3 — CID 103895848
4,4-dimethyl-5-[(4-methyl-3-nitro-2-pyridinyl)amino]pentan-1-ol (PubChem CID 103895848) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4,4-dimethyl-5-[(4-methyl-3-nitro-2-pyridinyl)amino]pentan-1-ol.
| Compound Name | 4,4-dimethyl-5-[(4-methyl-3-nitro-2-pyridinyl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 103895848 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4,4-dimethyl-5-[(4-methyl-3-nitro-2-pyridinyl)amino]pentan-1-ol |
| SMILES | Cc1ccnc(NCC(C)(C)CCCO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H21N3O3/c1-10-5-7-14-12(11(10)16(18)19)15-9-13(2,3)6-4-8-17/h5,7,17H,4,6,8-9H2,1-3H3,(H,14,15) |
| InChIKey | IAIRLUHNBGFJJG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|