C10H13F2N3O2 — CID 114384276
2,2-difluoro-N'-(4-methyl-3-nitrophenyl)propane-1,3-diamine (PubChem CID 114384276) has the molecular formula C10H13F2N3O2 and a molecular weight of 245.23 g/mol. Its IUPAC name is 2,2-difluoro-N'-(4-methyl-3-nitrophenyl)propane-1,3-diamine.
| Compound Name | 2,2-difluoro-N'-(4-methyl-3-nitrophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 114384276 |
| Molecular Formula | C10H13F2N3O2 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2,2-difluoro-N'-(4-methyl-3-nitrophenyl)propane-1,3-diamine |
| SMILES | Cc1ccc(NCC(F)(F)CN)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13F2N3O2/c1-7-2-3-8(4-9(7)15(16)17)14-6-10(11,12)5-13/h2-4,14H,5-6,13H2,1H3 |
| InChIKey | LFLBGUWAADOZGY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|