C12H19N3O2 — CID 62911112
N'-(4-methyl-3-nitrophenyl)-N-propylethane-1,2-diamine (PubChem CID 62911112) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is N'-(4-methyl-3-nitrophenyl)-N-propylethane-1,2-diamine.
| Compound Name | N'-(4-methyl-3-nitrophenyl)-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 62911112 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N'-(4-methyl-3-nitrophenyl)-N-propylethane-1,2-diamine |
| SMILES | CCCNCCNc1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H19N3O2/c1-3-6-13-7-8-14-11-5-4-10(2)12(9-11)15(16)17/h4-5,9,13-14H,3,6-8H2,1-2H3 |
| InChIKey | WDPYASHYSGTCDB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|