C11H15F2N3O — CID 114384441
4-[(3-amino-2,2-difluoropropyl)amino]-2-methylbenzamide (PubChem CID 114384441) has the molecular formula C11H15F2N3O and a molecular weight of 243.26 g/mol. Its IUPAC name is 4-[(3-amino-2,2-difluoropropyl)amino]-2-methylbenzamide.
| Compound Name | 4-[(3-amino-2,2-difluoropropyl)amino]-2-methylbenzamide |
|---|---|
| PubChem CID | 114384441 |
| Molecular Formula | C11H15F2N3O |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 4-[(3-amino-2,2-difluoropropyl)amino]-2-methylbenzamide |
| SMILES | Cc1cc(NCC(F)(F)CN)ccc1C(N)=O |
| InChI | InChI=1S/C11H15F2N3O/c1-7-4-8(2-3-9(7)10(15)17)16-6-11(12,13)5-14/h2-4,16H,5-6,14H2,1H3,(H2,15,17) |
| InChIKey | HGBNXCOLGVQUFK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |