C10H11F3N2S — CID 81278451
2-methyl-4-(2,2,2-trifluoroethylamino)benzenecarbothioamide (PubChem CID 81278451) has the molecular formula C10H11F3N2S and a molecular weight of 248.27 g/mol. Its IUPAC name is 2-methyl-4-(2,2,2-trifluoroethylamino)benzenecarbothioamide.
| Compound Name | 2-methyl-4-(2,2,2-trifluoroethylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 81278451 |
| Molecular Formula | C10H11F3N2S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-methyl-4-(2,2,2-trifluoroethylamino)benzenecarbothioamide |
| SMILES | Cc1cc(NCC(F)(F)F)ccc1C(N)=S |
| InChI | InChI=1S/C10H11F3N2S/c1-6-4-7(15-5-10(11,12)13)2-3-8(6)9(14)16/h2-4,15H,5H2,1H3,(H2,14,16) |
| InChIKey | CAZNVAHIVUJQSF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|