C14H22N2O3 — CID 66178811
2,4-dimethyl-1-(4-methyl-3-nitroanilino)pentan-2-ol (PubChem CID 66178811) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2,4-dimethyl-1-(4-methyl-3-nitroanilino)pentan-2-ol.
| Compound Name | 2,4-dimethyl-1-(4-methyl-3-nitroanilino)pentan-2-ol |
|---|---|
| PubChem CID | 66178811 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2,4-dimethyl-1-(4-methyl-3-nitroanilino)pentan-2-ol |
| SMILES | Cc1ccc(NCC(C)(O)CC(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H22N2O3/c1-10(2)8-14(4,17)9-15-12-6-5-11(3)13(7-12)16(18)19/h5-7,10,15,17H,8-9H2,1-4H3 |
| InChIKey | BUGHPLRMMWSJGT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|