C13H20N2O5 — CID 83013404
2-methyl-3-(4-nitro-3-propan-2-yloxyanilino)propane-1,2-diol (PubChem CID 83013404) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-methyl-3-(4-nitro-3-propan-2-yloxyanilino)propane-1,2-diol.
| Compound Name | 2-methyl-3-(4-nitro-3-propan-2-yloxyanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 83013404 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-methyl-3-(4-nitro-3-propan-2-yloxyanilino)propane-1,2-diol |
| SMILES | CC(C)Oc1cc(NCC(C)(O)CO)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H20N2O5/c1-9(2)20-12-6-10(4-5-11(12)15(18)19)14-7-13(3,17)8-16/h4-6,9,14,16-17H,7-8H2,1-3H3 |
| InChIKey | WJCFBARZOWCEJB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|