C13H20N2O5 — CID 83013242
1-methoxy-3-(4-nitro-3-propan-2-yloxyanilino)propan-2-ol (PubChem CID 83013242) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 1-methoxy-3-(4-nitro-3-propan-2-yloxyanilino)propan-2-ol.
| Compound Name | 1-methoxy-3-(4-nitro-3-propan-2-yloxyanilino)propan-2-ol |
|---|---|
| PubChem CID | 83013242 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-methoxy-3-(4-nitro-3-propan-2-yloxyanilino)propan-2-ol |
| SMILES | COCC(O)CNc1ccc([N+](=O)[O-])c(OC(C)C)c1 |
| InChI | InChI=1S/C13H20N2O5/c1-9(2)20-13-6-10(4-5-12(13)15(17)18)14-7-11(16)8-19-3/h4-6,9,11,14,16H,7-8H2,1-3H3 |
| InChIKey | GCDYTTXIPKJRGW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|