C15H24N2O3 — CID 103462587
N-(2,2-dimethylbutyl)-4-nitro-3-propan-2-yloxyaniline (PubChem CID 103462587) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-(2,2-dimethylbutyl)-4-nitro-3-propan-2-yloxyaniline.
| Compound Name | N-(2,2-dimethylbutyl)-4-nitro-3-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 103462587 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | N-(2,2-dimethylbutyl)-4-nitro-3-propan-2-yloxyaniline |
| SMILES | CCC(C)(C)CNc1ccc([N+](=O)[O-])c(OC(C)C)c1 |
| InChI | InChI=1S/C15H24N2O3/c1-6-15(4,5)10-16-12-7-8-13(17(18)19)14(9-12)20-11(2)3/h7-9,11,16H,6,10H2,1-5H3 |
| InChIKey | DKPAKWBZXLPEJV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|