C18H12F6N4O2 — CID 169099220
3,4-bis[4-amino-3-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione (PubChem CID 169099220) has the molecular formula C18H12F6N4O2 and a molecular weight of 430.31 g/mol. Its IUPAC name is 3,4-bis[4-amino-3-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3,4-bis[4-amino-3-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 169099220 |
| Molecular Formula | C18H12F6N4O2 |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 3,4-bis[4-amino-3-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione |
| SMILES | Nc1ccc(Nc2c(Nc3ccc(N)c(C(F)(F)F)c3)c(=O)c2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C18H12F6N4O2/c19-17(20,21)9-5-7(1-3-11(9)25)27-13-14(16(30)15(13)29)28-8-2-4-12(26)10(6-8)18(22,23)24/h1-6,27-28H,25-26H2 |
| InChIKey | MBWHOZJOYIAFOS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|