C13H9BrClF3N2 — CID 81263721
4-N-(2-bromo-5-chlorophenyl)-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 81263721) has the molecular formula C13H9BrClF3N2 and a molecular weight of 365.58 g/mol. Its IUPAC name is 4-N-(2-bromo-5-chlorophenyl)-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 4-N-(2-bromo-5-chlorophenyl)-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 81263721 |
| Molecular Formula | C13H9BrClF3N2 |
| Molecular Weight | 365.58 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 4-N-(2-bromo-5-chlorophenyl)-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2cc(Cl)ccc2Br)cc1C(F)(F)F |
| InChI | InChI=1S/C13H9BrClF3N2/c14-10-3-1-7(15)5-12(10)20-8-2-4-11(19)9(6-8)13(16,17)18/h1-6,20H,19H2 |
| InChIKey | WZEIPVYNMQSEEX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|