C15H14BrF3N2 — CID 65468688
4-N-(4-bromo-2,6-dimethylphenyl)-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 65468688) has the molecular formula C15H14BrF3N2 and a molecular weight of 359.19 g/mol. Its IUPAC name is 4-N-(4-bromo-2,6-dimethylphenyl)-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 4-N-(4-bromo-2,6-dimethylphenyl)-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 65468688 |
| Molecular Formula | C15H14BrF3N2 |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 4-N-(4-bromo-2,6-dimethylphenyl)-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | Cc1cc(Br)cc(C)c1Nc1ccc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H14BrF3N2/c1-8-5-10(16)6-9(2)14(8)21-11-3-4-13(20)12(7-11)15(17,18)19/h3-7,21H,20H2,1-2H3 |
| InChIKey | KYFPHQHANDFJOR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|