C13H9ClF4N2 — CID 29067548
4-N-(3-chloro-4-fluorophenyl)-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 29067548) has the molecular formula C13H9ClF4N2 and a molecular weight of 304.67 g/mol. Its IUPAC name is 4-N-(3-chloro-4-fluorophenyl)-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 4-N-(3-chloro-4-fluorophenyl)-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 29067548 |
| Molecular Formula | C13H9ClF4N2 |
| Molecular Weight | 304.67 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 4-N-(3-chloro-4-fluorophenyl)-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2ccc(F)c(Cl)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H9ClF4N2/c14-10-6-8(1-3-11(10)15)20-7-2-4-12(19)9(5-7)13(16,17)18/h1-6,20H,19H2 |
| InChIKey | ACMSNCUNGJSZGP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|