C15H14BrN3 — CID 115499574
2-amino-5-(4-bromo-2,6-dimethylanilino)benzonitrile (PubChem CID 115499574) has the molecular formula C15H14BrN3 and a molecular weight of 316.20 g/mol. Its IUPAC name is 2-amino-5-(4-bromo-2,6-dimethylanilino)benzonitrile.
| Compound Name | 2-amino-5-(4-bromo-2,6-dimethylanilino)benzonitrile |
|---|---|
| PubChem CID | 115499574 |
| Molecular Formula | C15H14BrN3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-amino-5-(4-bromo-2,6-dimethylanilino)benzonitrile |
| SMILES | Cc1cc(Br)cc(C)c1Nc1ccc(N)c(C#N)c1 |
| InChI | InChI=1S/C15H14BrN3/c1-9-5-12(16)6-10(2)15(9)19-13-3-4-14(18)11(7-13)8-17/h3-7,19H,18H2,1-2H3 |
| InChIKey | ASZYAVNWDCKKEE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|