C13H7F4N3 — CID 107643342
2-amino-5-(2,3,5,6-tetrafluoroanilino)benzonitrile (PubChem CID 107643342) has the molecular formula C13H7F4N3 and a molecular weight of 281.21 g/mol. Its IUPAC name is 2-amino-5-(2,3,5,6-tetrafluoroanilino)benzonitrile.
| Compound Name | 2-amino-5-(2,3,5,6-tetrafluoroanilino)benzonitrile |
|---|---|
| PubChem CID | 107643342 |
| Molecular Formula | C13H7F4N3 |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-amino-5-(2,3,5,6-tetrafluoroanilino)benzonitrile |
| SMILES | N#Cc1cc(Nc2c(F)c(F)cc(F)c2F)ccc1N |
| InChI | InChI=1S/C13H7F4N3/c14-8-4-9(15)12(17)13(11(8)16)20-7-1-2-10(19)6(3-7)5-18/h1-4,20H,19H2 |
| InChIKey | GHMCZINODZYBMR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|