C13H5F5N2 — CID 107644805
5-fluoro-2-(2,3,5,6-tetrafluoroanilino)benzonitrile (PubChem CID 107644805) has the molecular formula C13H5F5N2 and a molecular weight of 284.19 g/mol. Its IUPAC name is 5-fluoro-2-(2,3,5,6-tetrafluoroanilino)benzonitrile.
| Compound Name | 5-fluoro-2-(2,3,5,6-tetrafluoroanilino)benzonitrile |
|---|---|
| PubChem CID | 107644805 |
| Molecular Formula | C13H5F5N2 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 5-fluoro-2-(2,3,5,6-tetrafluoroanilino)benzonitrile |
| SMILES | N#Cc1cc(F)ccc1Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H5F5N2/c14-7-1-2-10(6(3-7)5-19)20-13-11(17)8(15)4-9(16)12(13)18/h1-4,20H |
| InChIKey | UQXGIHZDSWTVDI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|