C15H12BrFN2 — CID 65468036
2-(4-bromo-2,6-dimethylanilino)-5-fluorobenzonitrile (PubChem CID 65468036) has the molecular formula C15H12BrFN2 and a molecular weight of 319.18 g/mol. Its IUPAC name is 2-(4-bromo-2,6-dimethylanilino)-5-fluorobenzonitrile.
| Compound Name | 2-(4-bromo-2,6-dimethylanilino)-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 65468036 |
| Molecular Formula | C15H12BrFN2 |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 2-(4-bromo-2,6-dimethylanilino)-5-fluorobenzonitrile |
| SMILES | Cc1cc(Br)cc(C)c1Nc1ccc(F)cc1C#N |
| InChI | InChI=1S/C15H12BrFN2/c1-9-5-12(16)6-10(2)15(9)19-14-4-3-13(17)7-11(14)8-18/h3-7,19H,1-2H3 |
| InChIKey | YFNCTTYJQMBJIX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |