C13H7F3N2 — CID 55233913
2-(2,3-difluoroanilino)-5-fluorobenzonitrile (PubChem CID 55233913) has the molecular formula C13H7F3N2 and a molecular weight of 248.21 g/mol. Its IUPAC name is 2-(2,3-difluoroanilino)-5-fluorobenzonitrile.
| Compound Name | 2-(2,3-difluoroanilino)-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 55233913 |
| Molecular Formula | C13H7F3N2 |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-(2,3-difluoroanilino)-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)ccc1Nc1cccc(F)c1F |
| InChI | InChI=1S/C13H7F3N2/c14-9-4-5-11(8(6-9)7-17)18-12-3-1-2-10(15)13(12)16/h1-6,18H |
| InChIKey | CRTILFAJINMRKX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |