C14H8F4N2 — CID 82014691
5-fluoro-2-[(3,4,5-trifluorophenyl)methylamino]benzonitrile (PubChem CID 82014691) has the molecular formula C14H8F4N2 and a molecular weight of 280.22 g/mol. Its IUPAC name is 5-fluoro-2-[(3,4,5-trifluorophenyl)methylamino]benzonitrile.
| Compound Name | 5-fluoro-2-[(3,4,5-trifluorophenyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 82014691 |
| Molecular Formula | C14H8F4N2 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 5-fluoro-2-[(3,4,5-trifluorophenyl)methylamino]benzonitrile |
| SMILES | N#Cc1cc(F)ccc1NCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H8F4N2/c15-10-1-2-13(9(5-10)6-19)20-7-8-3-11(16)14(18)12(17)4-8/h1-5,20H,7H2 |
| InChIKey | BIOMFPGLFACGPN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|