C15H14FN3O2S — CID 75374034
[4-[(2-cyano-4-fluoroanilino)methyl]phenyl]methanesulfonamide (PubChem CID 75374034) has the molecular formula C15H14FN3O2S and a molecular weight of 319.36 g/mol. Its IUPAC name is [4-[(2-cyano-4-fluoroanilino)methyl]phenyl]methanesulfonamide.
| Compound Name | [4-[(2-cyano-4-fluoroanilino)methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 75374034 |
| Molecular Formula | C15H14FN3O2S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | [4-[(2-cyano-4-fluoroanilino)methyl]phenyl]methanesulfonamide |
| SMILES | N#Cc1cc(F)ccc1NCc1ccc(CS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H14FN3O2S/c16-14-5-6-15(13(7-14)8-17)19-9-11-1-3-12(4-2-11)10-22(18,20)21/h1-7,19H,9-10H2,(H2,18,20,21) |
| InChIKey | VMCPZNCRADKIRA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |