C16H16FN3 — CID 63674991
2-[[4-(2-aminoethyl)phenyl]methylamino]-5-fluorobenzonitrile (PubChem CID 63674991) has the molecular formula C16H16FN3 and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-[[4-(2-aminoethyl)phenyl]methylamino]-5-fluorobenzonitrile.
| Compound Name | 2-[[4-(2-aminoethyl)phenyl]methylamino]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 63674991 |
| Molecular Formula | C16H16FN3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[[4-(2-aminoethyl)phenyl]methylamino]-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)ccc1NCc1ccc(CCN)cc1 |
| InChI | InChI=1S/C16H16FN3/c17-15-5-6-16(14(9-15)10-19)20-11-13-3-1-12(2-4-13)7-8-18/h1-6,9,20H,7-8,11,18H2 |
| InChIKey | QWETWSKNPOYDPJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |