C14H7F5N2 — CID 107927707
5-methyl-2-(2,3,4,5,6-pentafluoroanilino)benzonitrile (PubChem CID 107927707) has the molecular formula C14H7F5N2 and a molecular weight of 298.21 g/mol. Its IUPAC name is 5-methyl-2-(2,3,4,5,6-pentafluoroanilino)benzonitrile.
| Compound Name | 5-methyl-2-(2,3,4,5,6-pentafluoroanilino)benzonitrile |
|---|---|
| PubChem CID | 107927707 |
| Molecular Formula | C14H7F5N2 |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 5-methyl-2-(2,3,4,5,6-pentafluoroanilino)benzonitrile |
| SMILES | Cc1ccc(Nc2c(F)c(F)c(F)c(F)c2F)c(C#N)c1 |
| InChI | InChI=1S/C14H7F5N2/c1-6-2-3-8(7(4-6)5-20)21-14-12(18)10(16)9(15)11(17)13(14)19/h2-4,21H,1H3 |
| InChIKey | KNYJTQBDPQTPGE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|