C14H8Cl2N4S — CID 107927574
2-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-5-methylbenzonitrile (PubChem CID 107927574) has the molecular formula C14H8Cl2N4S and a molecular weight of 335.22 g/mol. Its IUPAC name is 2-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-5-methylbenzonitrile.
| Compound Name | 2-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-5-methylbenzonitrile |
|---|---|
| PubChem CID | 107927574 |
| Molecular Formula | C14H8Cl2N4S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 2-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-5-methylbenzonitrile |
| SMILES | Cc1ccc(Nc2c(Cl)cc(Cl)c3c2N=S=N3)c(C#N)c1 |
| InChI | InChI=1S/C14H8Cl2N4S/c1-7-2-3-11(8(4-7)6-17)18-12-9(15)5-10(16)13-14(12)20-21-19-13/h2-5,18H,1H3 |
| InChIKey | YSLSIBDHBIKWJC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 60.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |