C12H6Cl2N6S — CID 103468626
3-amino-6-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]pyridine-2-carbonitrile (PubChem CID 103468626) has the molecular formula C12H6Cl2N6S and a molecular weight of 337.20 g/mol. Its IUPAC name is 3-amino-6-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]pyridine-2-carbonitrile.
| Compound Name | 3-amino-6-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 103468626 |
| Molecular Formula | C12H6Cl2N6S |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 3-amino-6-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]pyridine-2-carbonitrile |
| SMILES | N#Cc1nc(Nc2c(Cl)cc(Cl)c3c2N=S=N3)ccc1N |
| InChI | InChI=1S/C12H6Cl2N6S/c13-5-3-6(14)11-12(20-21-19-11)10(5)18-9-2-1-7(16)8(4-15)17-9/h1-3H,16H2,(H,17,18) |
| InChIKey | CXCDTBPWEVDXGS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 99.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |