C10H13N3 — CID 107927736
2-(2,2-dimethylhydrazinyl)-5-methylbenzonitrile (PubChem CID 107927736) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-(2,2-dimethylhydrazinyl)-5-methylbenzonitrile.
| Compound Name | 2-(2,2-dimethylhydrazinyl)-5-methylbenzonitrile |
|---|---|
| PubChem CID | 107927736 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-(2,2-dimethylhydrazinyl)-5-methylbenzonitrile |
| SMILES | Cc1ccc(NN(C)C)c(C#N)c1 |
| InChI | InChI=1S/C10H13N3/c1-8-4-5-10(12-13(2)3)9(6-8)7-11/h4-6,12H,1-3H3 |
| InChIKey | SZZSWACUBYGLRR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|