C14H9ClFN5 — CID 107787150
4-(4,6-diamino-3-chloro-2-fluoroanilino)benzene-1,2-dicarbonitrile (PubChem CID 107787150) has the molecular formula C14H9ClFN5 and a molecular weight of 301.71 g/mol. Its IUPAC name is 4-(4,6-diamino-3-chloro-2-fluoroanilino)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(4,6-diamino-3-chloro-2-fluoroanilino)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107787150 |
| Molecular Formula | C14H9ClFN5 |
| Molecular Weight | 301.71 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 4-(4,6-diamino-3-chloro-2-fluoroanilino)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Nc2c(N)cc(N)c(Cl)c2F)cc1C#N |
| InChI | InChI=1S/C14H9ClFN5/c15-12-10(19)4-11(20)14(13(12)16)21-9-2-1-7(5-17)8(3-9)6-18/h1-4,21H,19-20H2 |
| InChIKey | TYHSGWXGFQZUFT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.71 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|