C15H17ClFN3O — CID 103552628
5-chloro-6-fluoro-1-N-(4-propan-2-yloxyphenyl)benzene-1,2,4-triamine (PubChem CID 103552628) has the molecular formula C15H17ClFN3O and a molecular weight of 309.77 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1-N-(4-propan-2-yloxyphenyl)benzene-1,2,4-triamine.
| Compound Name | 5-chloro-6-fluoro-1-N-(4-propan-2-yloxyphenyl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 103552628 |
| Molecular Formula | C15H17ClFN3O |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 5-chloro-6-fluoro-1-N-(4-propan-2-yloxyphenyl)benzene-1,2,4-triamine |
| SMILES | CC(C)Oc1ccc(Nc2c(N)cc(N)c(Cl)c2F)cc1 |
| InChI | InChI=1S/C15H17ClFN3O/c1-8(2)21-10-5-3-9(4-6-10)20-15-12(19)7-11(18)13(16)14(15)17/h3-8,20H,18-19H2,1-2H3 |
| InChIKey | SITARQRGCBNJGY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|