C8H8ClF4N3 — CID 103552522
5-chloro-6-fluoro-1-N-(2,2,2-trifluoroethyl)benzene-1,2,4-triamine (PubChem CID 103552522) has the molecular formula C8H8ClF4N3 and a molecular weight of 257.62 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1-N-(2,2,2-trifluoroethyl)benzene-1,2,4-triamine.
| Compound Name | 5-chloro-6-fluoro-1-N-(2,2,2-trifluoroethyl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 103552522 |
| Molecular Formula | C8H8ClF4N3 |
| Molecular Weight | 257.62 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 5-chloro-6-fluoro-1-N-(2,2,2-trifluoroethyl)benzene-1,2,4-triamine |
| SMILES | Nc1cc(N)c(NCC(F)(F)F)c(F)c1Cl |
| InChI | InChI=1S/C8H8ClF4N3/c9-5-3(14)1-4(15)7(6(5)10)16-2-8(11,12)13/h1,16H,2,14-15H2 |
| InChIKey | BDGGFKHBHIUTNX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.62 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|