C14H22ClFN4 — CID 103553520
5-chloro-6-fluoro-1-N-[2-(1-methylpiperidin-4-yl)ethyl]benzene-1,2,4-triamine (PubChem CID 103553520) has the molecular formula C14H22ClFN4 and a molecular weight of 300.81 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1-N-[2-(1-methylpiperidin-4-yl)ethyl]benzene-1,2,4-triamine.
| Compound Name | 5-chloro-6-fluoro-1-N-[2-(1-methylpiperidin-4-yl)ethyl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 103553520 |
| Molecular Formula | C14H22ClFN4 |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 5-chloro-6-fluoro-1-N-[2-(1-methylpiperidin-4-yl)ethyl]benzene-1,2,4-triamine |
| SMILES | CN1CCC(CCNc2c(N)cc(N)c(Cl)c2F)CC1 |
| InChI | InChI=1S/C14H22ClFN4/c1-20-6-3-9(4-7-20)2-5-19-14-11(18)8-10(17)12(15)13(14)16/h8-9,19H,2-7,17-18H2,1H3 |
| InChIKey | CCQVTGJCYLNYNP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|