C15H23ClFN3O — CID 103553214
1-[(4,6-diamino-3-chloro-2-fluoroanilino)methyl]-4-ethylcyclohexan-1-ol (PubChem CID 103553214) has the molecular formula C15H23ClFN3O and a molecular weight of 315.82 g/mol. Its IUPAC name is 1-[(4,6-diamino-3-chloro-2-fluoroanilino)methyl]-4-ethylcyclohexan-1-ol.
| Compound Name | 1-[(4,6-diamino-3-chloro-2-fluoroanilino)methyl]-4-ethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 103553214 |
| Molecular Formula | C15H23ClFN3O |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-[(4,6-diamino-3-chloro-2-fluoroanilino)methyl]-4-ethylcyclohexan-1-ol |
| SMILES | CCC1CCC(O)(CNc2c(N)cc(N)c(Cl)c2F)CC1 |
| InChI | InChI=1S/C15H23ClFN3O/c1-2-9-3-5-15(21,6-4-9)8-20-14-11(19)7-10(18)12(16)13(14)17/h7,9,20-21H,2-6,8,18-19H2,1H3 |
| InChIKey | WWSOPCCZJGONLI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|