C14H21ClFN3 — CID 103553200
5-chloro-1-N-(3-ethylcyclohexyl)-6-fluorobenzene-1,2,4-triamine (PubChem CID 103553200) has the molecular formula C14H21ClFN3 and a molecular weight of 285.79 g/mol. Its IUPAC name is 5-chloro-1-N-(3-ethylcyclohexyl)-6-fluorobenzene-1,2,4-triamine.
| Compound Name | 5-chloro-1-N-(3-ethylcyclohexyl)-6-fluorobenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 103553200 |
| Molecular Formula | C14H21ClFN3 |
| Molecular Weight | 285.79 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 5-chloro-1-N-(3-ethylcyclohexyl)-6-fluorobenzene-1,2,4-triamine |
| SMILES | CCC1CCCC(Nc2c(N)cc(N)c(Cl)c2F)C1 |
| InChI | InChI=1S/C14H21ClFN3/c1-2-8-4-3-5-9(6-8)19-14-11(18)7-10(17)12(15)13(14)16/h7-9,19H,2-6,17-18H2,1H3 |
| InChIKey | VPCLXKRSRYZAFU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.79 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|