C11H15ClFN3S — CID 103553492
5-chloro-6-fluoro-1-N-(thian-3-yl)benzene-1,2,4-triamine (PubChem CID 103553492) has the molecular formula C11H15ClFN3S and a molecular weight of 275.78 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1-N-(thian-3-yl)benzene-1,2,4-triamine.
| Compound Name | 5-chloro-6-fluoro-1-N-(thian-3-yl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 103553492 |
| Molecular Formula | C11H15ClFN3S |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 5-chloro-6-fluoro-1-N-(thian-3-yl)benzene-1,2,4-triamine |
| SMILES | Nc1cc(N)c(NC2CCCSC2)c(F)c1Cl |
| InChI | InChI=1S/C11H15ClFN3S/c12-9-7(14)4-8(15)11(10(9)13)16-6-2-1-3-17-5-6/h4,6,16H,1-3,5,14-15H2 |
| InChIKey | YKWGMWFJMSVFLP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|