About 5-chloro-6-fluoro-1-N-(3-methylcyclobutyl)benzene-1,2,4-triamine
5-chloro-6-fluoro-1-N-(3-methylcyclobutyl)benzene-1,2,4-triamine (PubChem CID 103553462) has the molecular formula C11H15ClFN3
and a molecular weight of 243.71 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1-N-(3-methylcyclobutyl)benzene-1,2,4-triamine.
Molecular Properties
| Compound Name | 5-chloro-6-fluoro-1-N-(3-methylcyclobutyl)benzene-1,2,4-triamine |
| PubChem CID | 103553462 |
| Molecular Formula | C11H15ClFN3 |
| Molecular Weight | 243.71 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 5-chloro-6-fluoro-1-N-(3-methylcyclobutyl)benzene-1,2,4-triamine |
| SMILES | CC1CC(Nc2c(N)cc(N)c(Cl)c2F)C1 |
| InChI | InChI=1S/C11H15ClFN3/c1-5-2-6(3-5)16-11-8(15)4-7(14)9(12)10(11)13/h4-6,16H,2-3,14-15H2,1H3 |
| InChIKey | PEBSBACLVDJSIN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.71 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-6-fluoro-1-N-(3-methylcyclobutyl)benzene-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-fluoro-1-N-(3-methylcyclobutyl)benzene-1,2,4-triamine?
The IUPAC name of 5-chloro-6-fluoro-1-N-(3-methylcyclobutyl)benzene-1,2,4-triamine (CID 103553462) is 5-chloro-6-fluoro-1-N-(3-methylcyclobutyl)benzene-1,2,4-triamine.
What is the SMILES notation for 5-chloro-6-fluoro-1-N-(3-methylcyclobutyl)benzene-1,2,4-triamine?
The canonical SMILES for 5-chloro-6-fluoro-1-N-(3-methylcyclobutyl)benzene-1,2,4-triamine is CC1CC(Nc2c(N)cc(N)c(Cl)c2F)C1.
What is the InChIKey of 5-chloro-6-fluoro-1-N-(3-methylcyclobutyl)benzene-1,2,4-triamine?
The InChIKey is PEBSBACLVDJSIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClFN3/c1-5-2-6(3-5)16-11-8(15)4-7(14)9(12)10(11)13/h4-6,16H,2-3,14-15H2,1H3.
What are the key properties of 5-chloro-6-fluoro-1-N-(3-methylcyclobutyl)benzene-1,2,4-triamine?
5-chloro-6-fluoro-1-N-(3-methylcyclobutyl)benzene-1,2,4-triamine has a molecular weight of 243.71 g/mol, XLogP of 2.85, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-fluoro-1-N-(3-methylcyclobutyl)benzene-1,2,4-triamine is sourced from PubChem (CID 103553462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).