C14H15ClFN3 — CID 103552595
5-chloro-1-N-(2,5-dimethylphenyl)-6-fluorobenzene-1,2,4-triamine (PubChem CID 103552595) has the molecular formula C14H15ClFN3 and a molecular weight of 279.75 g/mol. Its IUPAC name is 5-chloro-1-N-(2,5-dimethylphenyl)-6-fluorobenzene-1,2,4-triamine.
| Compound Name | 5-chloro-1-N-(2,5-dimethylphenyl)-6-fluorobenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 103552595 |
| Molecular Formula | C14H15ClFN3 |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 5-chloro-1-N-(2,5-dimethylphenyl)-6-fluorobenzene-1,2,4-triamine |
| SMILES | Cc1ccc(C)c(Nc2c(N)cc(N)c(Cl)c2F)c1 |
| InChI | InChI=1S/C14H15ClFN3/c1-7-3-4-8(2)11(5-7)19-14-10(18)6-9(17)12(15)13(14)16/h3-6,19H,17-18H2,1-2H3 |
| InChIKey | XATOTLZNQKJJQV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|