C13H12Cl2FN3 — CID 103552626
5-chloro-1-N-(2-chloro-4-methylphenyl)-6-fluorobenzene-1,2,4-triamine (PubChem CID 103552626) has the molecular formula C13H12Cl2FN3 and a molecular weight of 300.16 g/mol. Its IUPAC name is 5-chloro-1-N-(2-chloro-4-methylphenyl)-6-fluorobenzene-1,2,4-triamine.
| Compound Name | 5-chloro-1-N-(2-chloro-4-methylphenyl)-6-fluorobenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 103552626 |
| Molecular Formula | C13H12Cl2FN3 |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 5-chloro-1-N-(2-chloro-4-methylphenyl)-6-fluorobenzene-1,2,4-triamine |
| SMILES | Cc1ccc(Nc2c(N)cc(N)c(Cl)c2F)c(Cl)c1 |
| InChI | InChI=1S/C13H12Cl2FN3/c1-6-2-3-10(7(14)4-6)19-13-9(18)5-8(17)11(15)12(13)16/h2-5,19H,17-18H2,1H3 |
| InChIKey | LNBNOULBBMAYGB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|