C14H14BrClFN3 — CID 103553340
1-N-(4-bromo-2-ethylphenyl)-5-chloro-6-fluorobenzene-1,2,4-triamine (PubChem CID 103553340) has the molecular formula C14H14BrClFN3 and a molecular weight of 358.64 g/mol. Its IUPAC name is 1-N-(4-bromo-2-ethylphenyl)-5-chloro-6-fluorobenzene-1,2,4-triamine.
| Compound Name | 1-N-(4-bromo-2-ethylphenyl)-5-chloro-6-fluorobenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 103553340 |
| Molecular Formula | C14H14BrClFN3 |
| Molecular Weight | 358.64 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 1-N-(4-bromo-2-ethylphenyl)-5-chloro-6-fluorobenzene-1,2,4-triamine |
| SMILES | CCc1cc(Br)ccc1Nc1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C14H14BrClFN3/c1-2-7-5-8(15)3-4-11(7)20-14-10(19)6-9(18)12(16)13(14)17/h3-6,20H,2,18-19H2,1H3 |
| InChIKey | XSOPPWUUOYUSIA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|