C13H9BrF4N2 — CID 81289293
N-(4-bromo-2-ethylphenyl)-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 81289293) has the molecular formula C13H9BrF4N2 and a molecular weight of 349.13 g/mol. Its IUPAC name is N-(4-bromo-2-ethylphenyl)-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-(4-bromo-2-ethylphenyl)-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 81289293 |
| Molecular Formula | C13H9BrF4N2 |
| Molecular Weight | 349.13 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | N-(4-bromo-2-ethylphenyl)-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | CCc1cc(Br)ccc1Nc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C13H9BrF4N2/c1-2-6-5-7(14)3-4-8(6)19-11-9(15)12(17)20-13(18)10(11)16/h3-5H,2H2,1H3,(H,19,20) |
| InChIKey | ODUKWWLYFGYUFZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.13 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|