C14H17F4N — CID 107643599
N-(3,5-dimethylcyclohexyl)-2,3,5,6-tetrafluoroaniline (PubChem CID 107643599) has the molecular formula C14H17F4N and a molecular weight of 275.29 g/mol. Its IUPAC name is N-(3,5-dimethylcyclohexyl)-2,3,5,6-tetrafluoroaniline.
| Compound Name | N-(3,5-dimethylcyclohexyl)-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 107643599 |
| Molecular Formula | C14H17F4N |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(3,5-dimethylcyclohexyl)-2,3,5,6-tetrafluoroaniline |
| SMILES | CC1CC(C)CC(Nc2c(F)c(F)cc(F)c2F)C1 |
| InChI | InChI=1S/C14H17F4N/c1-7-3-8(2)5-9(4-7)19-14-12(17)10(15)6-11(16)13(14)18/h6-9,19H,3-5H2,1-2H3 |
| InChIKey | KEYPQAMSGDFRTI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|