C24H13F14N3 — CID 101195364
cis-(1S,3R)-1-N,3-N-bis(2,3,4,5,6-pentafluorophenyl)-5-N-(2,3,4,5-tetrafluorophenyl)cyclohexane-1,3,5-triamine (PubChem CID 101195364) has the molecular formula C24H13F14N3 and a molecular weight of 609.36 g/mol. Its IUPAC name is cis-(1S,3R)-1-N,3-N-bis(2,3,4,5,6-pentafluorophenyl)-5-N-(2,3,4,5-tetrafluorophenyl)cyclohexane-1,3,5-triamine.
| Compound Name | cis-(1S,3R)-1-N,3-N-bis(2,3,4,5,6-pentafluorophenyl)-5-N-(2,3,4,5-tetrafluorophenyl)cyclohexane-1,3,5-triamine |
|---|---|
| PubChem CID | 101195364 |
| Molecular Formula | C24H13F14N3 |
| Molecular Weight | 609.36 g/mol |
| Exact Mass | 609.09 |
| IUPAC Name | cis-(1S,3R)-1-N,3-N-bis(2,3,4,5,6-pentafluorophenyl)-5-N-(2,3,4,5-tetrafluorophenyl)cyclohexane-1,3,5-triamine |
| SMILES | Fc1cc(NC2C[C@@H](Nc3c(F)c(F)c(F)c(F)c3F)C[C@@H](Nc3c(F)c(F)c(F)c(F)c3F)C2)c(F)c(F)c1F |
| InChI | InChI=1S/C24H13F14N3/c25-8-4-9(11(27)12(28)10(8)26)39-5-1-6(40-23-19(35)15(31)13(29)16(32)20(23)36)3-7(2-5)41-24-21(37)17(33)14(30)18(34)22(24)38/h4-7,39-41H,1-3H2/t5?,6-,7+ |
| InChIKey | LVDGTAPWFVGVAB-DGUCWDHESA-N |
| XLogP | 7.56 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.36 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|